C17H15ClF3N5S — CID 158852991
4-(chloromethyl)thiadiazole;3-methyl-6-[3-(trifluoromethyl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridine (PubChem CID 158852991) has the molecular formula C17H15ClF3N5S and a molecular weight of 413.86 g/mol. Its IUPAC name is 4-(chloromethyl)thiadiazole;3-methyl-6-[3-(trifluoromethyl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridine.
| Compound Name | 4-(chloromethyl)thiadiazole;3-methyl-6-[3-(trifluoromethyl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 158852991 |
| Molecular Formula | C17H15ClF3N5S |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 4-(chloromethyl)thiadiazole;3-methyl-6-[3-(trifluoromethyl)phenyl]-1,2-dihydroimidazo[4,5-b]pyridine |
| SMILES | CN1CNc2cc(-c3cccc(C(F)(F)F)c3)cnc21.ClCc1csnn1 |
| InChI | InChI=1S/C14H12F3N3.C3H3ClN2S/c1-20-8-19-12-6-10(7-18-13(12)20)9-3-2-4-11(5-9)14(15,16)17;4-1-3-2-7-6-5-3/h2-7,19H,8H2,1H3;2H,1H2 |
| InChIKey | IZRRBKAVFJZXBH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|