C29H41NO5Si — CID 15885331
tert-butyl (2R,3S,4S)-3-benzoyloxy-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 15885331) has the molecular formula C29H41NO5Si and a molecular weight of 511.74 g/mol. Its IUPAC name is tert-butyl (2R,3S,4S)-3-benzoyloxy-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,4S)-3-benzoyloxy-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15885331 |
| Molecular Formula | C29H41NO5Si |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | tert-butyl (2R,3S,4S)-3-benzoyloxy-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC(=O)c2ccccc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C29H41NO5Si/c1-28(2,3)34-27(32)30-20-24(35-36(7,8)29(4,5)6)25(23(30)19-21-15-11-9-12-16-21)33-26(31)22-17-13-10-14-18-22/h9-18,23-25H,19-20H2,1-8H3/t23-,24+,25+/m1/s1 |
| InChIKey | PEUSUKZZABXNOJ-DSITVLBTSA-N |
| XLogP | 6.46 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|