C13H12N2V — CID 158853531
4-(2,3-dimethylphenyl)-1H-pyrrole-3-carbonitrile;vanadium (PubChem CID 158853531) has the molecular formula C13H12N2V and a molecular weight of 247.20 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-1H-pyrrole-3-carbonitrile;vanadium.
| Compound Name | 4-(2,3-dimethylphenyl)-1H-pyrrole-3-carbonitrile;vanadium |
|---|---|
| PubChem CID | 158853531 |
| Molecular Formula | C13H12N2V |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-1H-pyrrole-3-carbonitrile;vanadium |
| SMILES | Cc1cccc(-c2c[nH]cc2C#N)c1C.[V] |
| InChI | InChI=1S/C13H12N2.V/c1-9-4-3-5-12(10(9)2)13-8-15-7-11(13)6-14;/h3-5,7-8,15H,1-2H3; |
| InChIKey | IZTIUUYFBNDZJM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |