C46H40BBrN6O4 — CID 158853862
(3-aminophenyl)boronic acid;3-bromo-5-isocyano-1-[(3-methoxyphenyl)methyl]indole;3-[5-isocyano-1-[(3-methoxyphenyl)methyl]indol-3-yl]aniline (PubChem CID 158853862) has the molecular formula C46H40BBrN6O4 and a molecular weight of 831.58 g/mol. Its IUPAC name is (3-aminophenyl)boronic acid;3-bromo-5-isocyano-1-[(3-methoxyphenyl)methyl]indole;3-[5-isocyano-1-[(3-methoxyphenyl)methyl]indol-3-yl]aniline.
| Compound Name | (3-aminophenyl)boronic acid;3-bromo-5-isocyano-1-[(3-methoxyphenyl)methyl]indole;3-[5-isocyano-1-[(3-methoxyphenyl)methyl]indol-3-yl]aniline |
|---|---|
| PubChem CID | 158853862 |
| Molecular Formula | C46H40BBrN6O4 |
| Molecular Weight | 831.58 g/mol |
| Exact Mass | 830.24 |
| IUPAC Name | (3-aminophenyl)boronic acid;3-bromo-5-isocyano-1-[(3-methoxyphenyl)methyl]indole;3-[5-isocyano-1-[(3-methoxyphenyl)methyl]indol-3-yl]aniline |
| SMILES | Nc1cccc(B(O)O)c1.[C-]#[N+]c1ccc2c(c1)c(-c1cccc(N)c1)cn2Cc1cccc(OC)c1.[C-]#[N+]c1ccc2c(c1)c(Br)cn2Cc1cccc(OC)c1 |
| InChI | InChI=1S/C23H19N3O.C17H13BrN2O.C6H8BNO2/c1-25-19-9-10-23-21(13-19)22(17-6-4-7-18(24)12-17)15-26(23)14-16-5-3-8-20(11-16)27-2;1-19-13-6-7-17-15(9-13)16(18)11-20(17)10-12-4-3-5-14(8-12)21-2;8-6-3-1-2-5(4-6)7(9)10/h3-13,15H,14,24H2,2H3;3-9,11H,10H2,2H3;1-4,9-10H,8H2 |
| InChIKey | IZUHEIATZKOLKM-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 129.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.58 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|