C31H50O3 — CID 158854601
5-ethyl-6-[[5-methyl-8-(3-methylbutyl)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]nonane-2,4-dione;propane (PubChem CID 158854601) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is 5-ethyl-6-[[5-methyl-8-(3-methylbutyl)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]nonane-2,4-dione;propane.
| Compound Name | 5-ethyl-6-[[5-methyl-8-(3-methylbutyl)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]nonane-2,4-dione;propane |
|---|---|
| PubChem CID | 158854601 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | 5-ethyl-6-[[5-methyl-8-(3-methylbutyl)-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]nonane-2,4-dione;propane |
| SMILES | CCC.CCCC(CC1CC(=O)c2c(C)ccc(CCC(C)C)c2C1)C(CC)C(=O)CC(C)=O |
| InChI | InChI=1S/C28H42O3.C3H8/c1-7-9-23(24(8-2)26(30)14-20(6)29)15-21-16-25-22(12-10-18(3)4)13-11-19(5)28(25)27(31)17-21;1-3-2/h11,13,18,21,23-24H,7-10,12,14-17H2,1-6H3;3H2,1-2H3 |
| InChIKey | IZWQIGOFKJDQOX-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|