C32H35NO4 — CID 15885631
1-[benzyl(methyl)amino]-3-[bis(4-methoxyphenyl)-phenylmethoxy]propan-2-ol (PubChem CID 15885631) has the molecular formula C32H35NO4 and a molecular weight of 497.64 g/mol. Its IUPAC name is 1-[benzyl(methyl)amino]-3-[bis(4-methoxyphenyl)-phenylmethoxy]propan-2-ol.
| Compound Name | 1-[benzyl(methyl)amino]-3-[bis(4-methoxyphenyl)-phenylmethoxy]propan-2-ol |
|---|---|
| PubChem CID | 15885631 |
| Molecular Formula | C32H35NO4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 1-[benzyl(methyl)amino]-3-[bis(4-methoxyphenyl)-phenylmethoxy]propan-2-ol |
| SMILES | COc1ccc(C(OCC(O)CN(C)Cc2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H35NO4/c1-33(22-25-10-6-4-7-11-25)23-29(34)24-37-32(26-12-8-5-9-13-26,27-14-18-30(35-2)19-15-27)28-16-20-31(36-3)21-17-28/h4-21,29,34H,22-24H2,1-3H3 |
| InChIKey | QEPJNTRLYTUBBU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|