C40H64O2 — CID 158856383
1,3-bis(3,5-ditert-butylphenyl)propan-2-one;2,6-dimethylheptan-4-one (PubChem CID 158856383) has the molecular formula C40H64O2 and a molecular weight of 576.95 g/mol. Its IUPAC name is 1,3-bis(3,5-ditert-butylphenyl)propan-2-one;2,6-dimethylheptan-4-one.
| Compound Name | 1,3-bis(3,5-ditert-butylphenyl)propan-2-one;2,6-dimethylheptan-4-one |
|---|---|
| PubChem CID | 158856383 |
| Molecular Formula | C40H64O2 |
| Molecular Weight | 576.95 g/mol |
| Exact Mass | 576.49 |
| IUPAC Name | 1,3-bis(3,5-ditert-butylphenyl)propan-2-one;2,6-dimethylheptan-4-one |
| SMILES | CC(C)(C)c1cc(CC(=O)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1.CC(C)CC(=O)CC(C)C |
| InChI | InChI=1S/C31H46O.C9H18O/c1-28(2,3)23-13-21(14-24(19-23)29(4,5)6)17-27(32)18-22-15-25(30(7,8)9)20-26(16-22)31(10,11)12;1-7(2)5-9(10)6-8(3)4/h13-16,19-20H,17-18H2,1-12H3;7-8H,5-6H2,1-4H3 |
| InChIKey | JACJJAVEAUWHEK-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.95 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |