C30H37ClN2O — CID 158856696
1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15)-tetraene;2-chlorocyclohexan-1-one;1,2,3,4-tetrahydroquinoline (PubChem CID 158856696) has the molecular formula C30H37ClN2O and a molecular weight of 477.09 g/mol. Its IUPAC name is 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15)-tetraene;2-chlorocyclohexan-1-one;1,2,3,4-tetrahydroquinoline.
| Compound Name | 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15)-tetraene;2-chlorocyclohexan-1-one;1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 158856696 |
| Molecular Formula | C30H37ClN2O |
| Molecular Weight | 477.09 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15)-tetraene;2-chlorocyclohexan-1-one;1,2,3,4-tetrahydroquinoline |
| SMILES | O=C1CCCCC1Cl.c1cc2c3c(c1)c1c(n3CCC2)CCCC1.c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C15H17N.C9H11N.C6H9ClO/c1-2-9-14-12(7-1)13-8-3-5-11-6-4-10-16(14)15(11)13;1-2-6-9-8(4-1)5-3-7-10-9;7-5-3-1-2-4-6(5)8/h3,5,8H,1-2,4,6-7,9-10H2;1-2,4,6,10H,3,5,7H2;5H,1-4H2 |
| InChIKey | JADJQAKIEHVNIP-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.09 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|