C18H16O2 — CID 158856851
(3aR,11cS)-5-methyl-3-methylidene-3a,4,5,11c-tetrahydronaphtho[2,1-g][1]benzofuran-2-one (PubChem CID 158856851) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is (3aR,11cS)-5-methyl-3-methylidene-3a,4,5,11c-tetrahydronaphtho[2,1-g][1]benzofuran-2-one.
| Compound Name | (3aR,11cS)-5-methyl-3-methylidene-3a,4,5,11c-tetrahydronaphtho[2,1-g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 158856851 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (3aR,11cS)-5-methyl-3-methylidene-3a,4,5,11c-tetrahydronaphtho[2,1-g][1]benzofuran-2-one |
| SMILES | C=C1C(=O)O[C@@H]2c3c(ccc4ccccc34)C(C)C[C@H]12 |
| InChI | InChI=1S/C18H16O2/c1-10-9-15-11(2)18(19)20-17(15)16-13(10)8-7-12-5-3-4-6-14(12)16/h3-8,10,15,17H,2,9H2,1H3/t10?,15-,17+/m1/s1 |
| InChIKey | JADWKPQFGKXDFS-KTITXKAJSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|