About 1-methylpiperidin-4-amine;oxan-4-ylmethanamine
1-methylpiperidin-4-amine;oxan-4-ylmethanamine (PubChem CID 158856884) has the molecular formula C12H27N3O
and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-methylpiperidin-4-amine;oxan-4-ylmethanamine.
Molecular Properties
| Compound Name | 1-methylpiperidin-4-amine;oxan-4-ylmethanamine |
| PubChem CID | 158856884 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 1-methylpiperidin-4-amine;oxan-4-ylmethanamine |
| SMILES | CN1CCC(N)CC1.NCC1CCOCC1 |
| InChI | InChI=1S/C6H14N2.C6H13NO/c1-8-4-2-6(7)3-5-8;7-5-6-1-3-8-4-2-6/h6H,2-5,7H2,1H3;6H,1-5,7H2 |
| InChIKey | JADZGKVEFRBPKC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylpiperidin-4-amine;oxan-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidin-4-amine;oxan-4-ylmethanamine?
The IUPAC name of 1-methylpiperidin-4-amine;oxan-4-ylmethanamine (CID 158856884) is 1-methylpiperidin-4-amine;oxan-4-ylmethanamine.
What is the SMILES notation for 1-methylpiperidin-4-amine;oxan-4-ylmethanamine?
The canonical SMILES for 1-methylpiperidin-4-amine;oxan-4-ylmethanamine is CN1CCC(N)CC1.NCC1CCOCC1.
What is the InChIKey of 1-methylpiperidin-4-amine;oxan-4-ylmethanamine?
The InChIKey is JADZGKVEFRBPKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.C6H13NO/c1-8-4-2-6(7)3-5-8;7-5-6-1-3-8-4-2-6/h6H,2-5,7H2,1H3;6H,1-5,7H2.
What are the key properties of 1-methylpiperidin-4-amine;oxan-4-ylmethanamine?
1-methylpiperidin-4-amine;oxan-4-ylmethanamine has a molecular weight of 229.37 g/mol, XLogP of 0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidin-4-amine;oxan-4-ylmethanamine is sourced from PubChem (CID 158856884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).