About O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane
O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane (PubChem CID 158858291) has the molecular formula C28H37NO2S
and a molecular weight of 451.68 g/mol. Its IUPAC name is O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane.
Molecular Properties
| Compound Name | O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane |
| PubChem CID | 158858291 |
| Molecular Formula | C28H37NO2S |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane |
| SMILES | CC(C)(OC12CC3CC(CC(C3)C1)C2)c1ccccc1.CCOC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C19H26O.C9H11NOS/c1-18(2,17-6-4-3-5-7-17)20-19-11-14-8-15(12-19)10-16(9-14)13-19;1-2-11-9(12)10-8-6-4-3-5-7-8/h3-7,14-16H,8-13H2,1-2H3;3-7H,2H2,1H3,(H,10,12) |
| InChIKey | JAILXLFQXRJBKJ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane?
The IUPAC name of O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane (CID 158858291) is O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane.
What is the SMILES notation for O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane?
The canonical SMILES for O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane is CC(C)(OC12CC3CC(CC(C3)C1)C2)c1ccccc1.CCOC(=S)Nc1ccccc1.
What is the InChIKey of O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane?
The InChIKey is JAILXLFQXRJBKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O.C9H11NOS/c1-18(2,17-6-4-3-5-7-17)20-19-11-14-8-15(12-19)10-16(9-14)13-19;1-2-11-9(12)10-8-6-4-3-5-7-8/h3-7,14-16H,8-13H2,1-2H3;3-7H,2H2,1H3,(H,10,12).
What are the key properties of O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane?
O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane has a molecular weight of 451.68 g/mol, XLogP of 7.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethyl N-phenylcarbamothioate;1-(2-phenylpropan-2-yloxy)adamantane is sourced from PubChem (CID 158858291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).