C19H18Br2N2 — CID 15885882
1-(4-bromophenyl)-3-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-4-ium bromide (PubChem CID 15885882) has the molecular formula C19H18Br2N2 and a molecular weight of 434.18 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-4-ium bromide.
| Compound Name | 1-(4-bromophenyl)-3-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-4-ium bromide |
|---|---|
| PubChem CID | 15885882 |
| Molecular Formula | C19H18Br2N2 |
| Molecular Weight | 434.18 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | 1-(4-bromophenyl)-3-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-4-ium bromide |
| SMILES | Brc1ccc(-n2cc(-c3ccccc3)[n+]3c2CCCC3)cc1.[Br-] |
| InChI | InChI=1S/C19H18BrN2.BrH/c20-16-9-11-17(12-10-16)22-14-18(15-6-2-1-3-7-15)21-13-5-4-8-19(21)22;/h1-3,6-7,9-12,14H,4-5,8,13H2;1H/q+1;/p-1 |
| InChIKey | YAPNWJDBNGFVLM-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|