About 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile
3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile (PubChem CID 158858945) has the molecular formula C18H18N4O
and a molecular weight of 306.37 g/mol. Its IUPAC name is 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile |
| PubChem CID | 158858945 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile |
| SMILES | N#Cc1cccc(C2=CCC3N=CNC(N4CCOCC4)=C23)c1 |
| InChI | InChI=1S/C18H18N4O/c19-11-13-2-1-3-14(10-13)15-4-5-16-17(15)18(21-12-20-16)22-6-8-23-9-7-22/h1-4,10,12,16H,5-9H2,(H,20,21) |
| InChIKey | UYBUSXUSTMWYNP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 60.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile?
The IUPAC name of 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile (CID 158858945) is 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile.
What is the SMILES notation for 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile?
The canonical SMILES for 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile is N#Cc1cccc(C2=CCC3N=CNC(N4CCOCC4)=C23)c1.
What is the InChIKey of 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile?
The InChIKey is UYBUSXUSTMWYNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O/c19-11-13-2-1-3-14(10-13)15-4-5-16-17(15)18(21-12-20-16)22-6-8-23-9-7-22/h1-4,10,12,16H,5-9H2,(H,20,21).
What are the key properties of 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile?
3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile has a molecular weight of 306.37 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-morpholin-4-yl-7,7a-dihydro-3H-cyclopenta[d]pyrimidin-5-yl)benzonitrile is sourced from PubChem (CID 158858945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).