C16H6Cl4F2N2O5 — CID 158859238
2,4-dichloro-3-cyano-5-fluorobenzoic acid;2,4-dichloro-5-fluoro-3-(hydroxyiminomethyl)benzoic acid (PubChem CID 158859238) has the molecular formula C16H6Cl4F2N2O5 and a molecular weight of 486.04 g/mol. Its IUPAC name is 2,4-dichloro-3-cyano-5-fluorobenzoic acid;2,4-dichloro-5-fluoro-3-(hydroxyiminomethyl)benzoic acid.
| Compound Name | 2,4-dichloro-3-cyano-5-fluorobenzoic acid;2,4-dichloro-5-fluoro-3-(hydroxyiminomethyl)benzoic acid |
|---|---|
| PubChem CID | 158859238 |
| Molecular Formula | C16H6Cl4F2N2O5 |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 483.90 |
| IUPAC Name | 2,4-dichloro-3-cyano-5-fluorobenzoic acid;2,4-dichloro-5-fluoro-3-(hydroxyiminomethyl)benzoic acid |
| SMILES | N#Cc1c(Cl)c(F)cc(C(=O)O)c1Cl.O=C(O)c1cc(F)c(Cl)c(C=NO)c1Cl |
| InChI | InChI=1S/C8H4Cl2FNO3.C8H2Cl2FNO2/c9-6-3(8(13)14)1-5(11)7(10)4(6)2-12-15;9-6-3(8(13)14)1-5(11)7(10)4(6)2-12/h1-2,15H,(H,13,14);1H,(H,13,14) |
| InChIKey | JALHZOTWDQGCSF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|