C42H51ClN8O4 — CID 158859870
aniline;4-chloro-5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-1,4-dihydropyrimidin-2-amine;5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 158859870) has the molecular formula C42H51ClN8O4 and a molecular weight of 767.38 g/mol. Its IUPAC name is aniline;4-chloro-5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-1,4-dihydropyrimidin-2-amine;5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-4-N-phenylpyrimidine-2,4-diamine.
| Compound Name | aniline;4-chloro-5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-1,4-dihydropyrimidin-2-amine;5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-4-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 158859870 |
| Molecular Formula | C42H51ClN8O4 |
| Molecular Weight | 767.38 g/mol |
| Exact Mass | 766.37 |
| IUPAC Name | aniline;4-chloro-5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-1,4-dihydropyrimidin-2-amine;5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | COc1cc(C(C)C)c(OC2=CNC(N)=NC2Cl)cc1C.COc1cc(C(C)C)c(Oc2cnc(N)nc2Nc2ccccc2)cc1C.Nc1ccccc1 |
| InChI | InChI=1S/C21H24N4O2.C15H20ClN3O2.C6H7N/c1-13(2)16-11-17(26-4)14(3)10-18(16)27-19-12-23-21(22)25-20(19)24-15-8-6-5-7-9-15;1-8(2)10-6-11(20-4)9(3)5-12(10)21-13-7-18-15(17)19-14(13)16;7-6-4-2-1-3-5-6/h5-13H,1-4H3,(H3,22,23,24,25);5-8,14H,1-4H3,(H3,17,18,19);1-5H,7H2 |
| InChIKey | JANGVMRIQMIZSK-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 177.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.38 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|