C13H20O3 — CID 158859882
3',4,7,7-tetramethylspiro[bicyclo[2.2.1]heptane-3,2'-oxirane]-1-carboxylic acid (PubChem CID 158859882) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3',4,7,7-tetramethylspiro[bicyclo[2.2.1]heptane-3,2'-oxirane]-1-carboxylic acid.
| Compound Name | 3',4,7,7-tetramethylspiro[bicyclo[2.2.1]heptane-3,2'-oxirane]-1-carboxylic acid |
|---|---|
| PubChem CID | 158859882 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 3',4,7,7-tetramethylspiro[bicyclo[2.2.1]heptane-3,2'-oxirane]-1-carboxylic acid |
| SMILES | CC1OC12CC1(C(=O)O)CCC2(C)C1(C)C |
| InChI | InChI=1S/C13H20O3/c1-8-13(16-8)7-12(9(14)15)6-5-11(13,4)10(12,2)3/h8H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | JANHUZKHZOCSSU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|