C11H12N2O5S2 — CID 158860060
methyl 2-sulfanylacetate;3-oxo-4H-pyrido[3,2-b][1,4]thiazine-6-carboxylic acid (PubChem CID 158860060) has the molecular formula C11H12N2O5S2 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 2-sulfanylacetate;3-oxo-4H-pyrido[3,2-b][1,4]thiazine-6-carboxylic acid.
| Compound Name | methyl 2-sulfanylacetate;3-oxo-4H-pyrido[3,2-b][1,4]thiazine-6-carboxylic acid |
|---|---|
| PubChem CID | 158860060 |
| Molecular Formula | C11H12N2O5S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | methyl 2-sulfanylacetate;3-oxo-4H-pyrido[3,2-b][1,4]thiazine-6-carboxylic acid |
| SMILES | COC(=O)CS.O=C1CSc2ccc(C(=O)O)nc2N1 |
| InChI | InChI=1S/C8H6N2O3S.C3H6O2S/c11-6-3-14-5-2-1-4(8(12)13)9-7(5)10-6;1-5-3(4)2-6/h1-2H,3H2,(H,12,13)(H,9,10,11);6H,2H2,1H3 |
| InChIKey | JANTUDYHRLYUEV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|