C22H26N2O4 — CID 158860087
(4aR,8aS)-6-[3-[2-[2-(methoxymethyl)phenyl]ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 158860087) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-[2-[2-(methoxymethyl)phenyl]ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[3-[2-[2-(methoxymethyl)phenyl]ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 158860087 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (4aR,8aS)-6-[3-[2-[2-(methoxymethyl)phenyl]ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | COCc1ccccc1C#CC1CN(C(=O)N2CC[C@@H]3OCC(=O)C[C@@H]3C2)C1 |
| InChI | InChI=1S/C22H26N2O4/c1-27-14-18-5-3-2-4-17(18)7-6-16-11-24(12-16)22(26)23-9-8-21-19(13-23)10-20(25)15-28-21/h2-5,16,19,21H,8-15H2,1H3/t19-,21+/m1/s1 |
| InChIKey | JANVKNBVVQYESA-CTNGQTDRSA-N |
| XLogP | 1.92 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|