C19H21ClFN3O — CID 15886060
(7S,8aS)-2-(5-chloro-2-pyridinyl)-7-[(4-fluorophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 15886060) has the molecular formula C19H21ClFN3O and a molecular weight of 361.85 g/mol. Its IUPAC name is (7S,8aS)-2-(5-chloro-2-pyridinyl)-7-[(4-fluorophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7S,8aS)-2-(5-chloro-2-pyridinyl)-7-[(4-fluorophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 15886060 |
| Molecular Formula | C19H21ClFN3O |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (7S,8aS)-2-(5-chloro-2-pyridinyl)-7-[(4-fluorophenyl)methoxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Fc1ccc(CO[C@H]2C[C@H]3CN(c4ccc(Cl)cn4)CCN3C2)cc1 |
| InChI | InChI=1S/C19H21ClFN3O/c20-15-3-6-19(22-10-15)24-8-7-23-12-18(9-17(23)11-24)25-13-14-1-4-16(21)5-2-14/h1-6,10,17-18H,7-9,11-13H2/t17-,18-/m0/s1 |
| InChIKey | KTNLKNZYVOELFG-ROUUACIJSA-N |
| XLogP | 3.35 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |