C24H26N4O2 — CID 158860788
1-(4-methylphenyl)-9-[4-(1,2,4,5-tetrazin-3-yl)phenyl]nonane-3,7-dione (PubChem CID 158860788) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-(4-methylphenyl)-9-[4-(1,2,4,5-tetrazin-3-yl)phenyl]nonane-3,7-dione.
| Compound Name | 1-(4-methylphenyl)-9-[4-(1,2,4,5-tetrazin-3-yl)phenyl]nonane-3,7-dione |
|---|---|
| PubChem CID | 158860788 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-(4-methylphenyl)-9-[4-(1,2,4,5-tetrazin-3-yl)phenyl]nonane-3,7-dione |
| SMILES | Cc1ccc(CCC(=O)CCCC(=O)CCc2ccc(-c3nncnn3)cc2)cc1 |
| InChI | InChI=1S/C24H26N4O2/c1-18-5-7-19(8-6-18)11-15-22(29)3-2-4-23(30)16-12-20-9-13-21(14-10-20)24-27-25-17-26-28-24/h5-10,13-14,17H,2-4,11-12,15-16H2,1H3 |
| InChIKey | ZJJMAUNZDJFDBF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |