About 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan
3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan (PubChem CID 158860885) has the molecular formula C11H7F2N3O3S
and a molecular weight of 299.26 g/mol. Its IUPAC name is 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan.
Molecular Properties
| Compound Name | 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan |
| PubChem CID | 158860885 |
| Molecular Formula | C11H7F2N3O3S |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan |
| SMILES | [N-]=[N+]=Nc1c(F)ccc(CS(=O)(=O)c2ccoc2)c1F |
| InChI | InChI=1S/C11H7F2N3O3S/c12-9-2-1-7(10(13)11(9)15-16-14)6-20(17,18)8-3-4-19-5-8/h1-5H,6H2 |
| InChIKey | JAQGEGSCHSTLFY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan?
The IUPAC name of 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan (CID 158860885) is 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan.
What is the SMILES notation for 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan?
The canonical SMILES for 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan is [N-]=[N+]=Nc1c(F)ccc(CS(=O)(=O)c2ccoc2)c1F.
What is the InChIKey of 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan?
The InChIKey is JAQGEGSCHSTLFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F2N3O3S/c12-9-2-1-7(10(13)11(9)15-16-14)6-20(17,18)8-3-4-19-5-8/h1-5H,6H2.
What are the key properties of 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan?
3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan has a molecular weight of 299.26 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-azido-2,4-difluorophenyl)methylsulfonyl]furan is sourced from PubChem (CID 158860885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).