C38H86O22 — CID 158862106
pentakis((2S,3R)-butane-1,2,3,4-tetrol);2-heptylundecanoic acid (PubChem CID 158862106) has the molecular formula C38H86O22 and a molecular weight of 895.08 g/mol. Its IUPAC name is pentakis((2S,3R)-butane-1,2,3,4-tetrol);2-heptylundecanoic acid.
| Compound Name | pentakis((2S,3R)-butane-1,2,3,4-tetrol);2-heptylundecanoic acid |
|---|---|
| PubChem CID | 158862106 |
| Molecular Formula | C38H86O22 |
| Molecular Weight | 895.08 g/mol |
| Exact Mass | 894.56 |
| IUPAC Name | pentakis((2S,3R)-butane-1,2,3,4-tetrol);2-heptylundecanoic acid |
| SMILES | CCCCCCCCCC(CCCCCCC)C(=O)O.OC[C@@H](O)[C@@H](O)CO.OC[C@@H](O)[C@@H](O)CO.OC[C@@H](O)[C@@H](O)CO.OC[C@@H](O)[C@@H](O)CO.OC[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C18H36O2.5C4H10O4/c1-3-5-7-9-10-12-14-16-17(18(19)20)15-13-11-8-6-4-2;5*5-1-3(7)4(8)2-6/h17H,3-16H2,1-2H3,(H,19,20);5*3-8H,1-2H2/t;5*3-,4+ |
| InChIKey | JATYXITUSHLQOQ-QEMDMZNVSA-N |
| XLogP | -5.35 |
| TPSA | 441.90 Ų |
| H-Bond Donors | 21 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.08 |
| LogP ≤ 5 | -5.35 |
| H-Bond Donors ≤ 5 | 21 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|