C53H63F3N4O4S — CID 158863633
5,6-bis(3-tert-butyl-5-methylphenyl)-1H-pyrazin-2-one;[5,6-bis(3-tert-butyl-5-methylphenyl)pyrazin-2-yl] trifluoromethanesulfonate (PubChem CID 158863633) has the molecular formula C53H63F3N4O4S and a molecular weight of 909.17 g/mol. Its IUPAC name is 5,6-bis(3-tert-butyl-5-methylphenyl)-1H-pyrazin-2-one;[5,6-bis(3-tert-butyl-5-methylphenyl)pyrazin-2-yl] trifluoromethanesulfonate.
| Compound Name | 5,6-bis(3-tert-butyl-5-methylphenyl)-1H-pyrazin-2-one;[5,6-bis(3-tert-butyl-5-methylphenyl)pyrazin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158863633 |
| Molecular Formula | C53H63F3N4O4S |
| Molecular Weight | 909.17 g/mol |
| Exact Mass | 908.45 |
| IUPAC Name | 5,6-bis(3-tert-butyl-5-methylphenyl)-1H-pyrazin-2-one;[5,6-bis(3-tert-butyl-5-methylphenyl)pyrazin-2-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(-c2ncc(=O)[nH]c2-c2cc(C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1.Cc1cc(-c2ncc(OS(=O)(=O)C(F)(F)F)nc2-c2cc(C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H31F3N2O3S.C26H32N2O/c1-16-9-18(13-20(11-16)25(3,4)5)23-24(19-10-17(2)12-21(14-19)26(6,7)8)32-22(15-31-23)35-36(33,34)27(28,29)30;1-16-9-18(13-20(11-16)25(3,4)5)23-24(28-22(29)15-27-23)19-10-17(2)12-21(14-19)26(6,7)8/h9-15H,1-8H3;9-15H,1-8H3,(H,28,29) |
| InChIKey | JAYKUJGIYVXNNW-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.17 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|