C7H15NO4Si — CID 158864031
(8-ethyl-1,4,6,9-tetraoxa-5-silaspiro[4.4]nonan-3-yl)methanamine (PubChem CID 158864031) has the molecular formula C7H15NO4Si and a molecular weight of 205.29 g/mol. Its IUPAC name is (8-ethyl-1,4,6,9-tetraoxa-5-silaspiro[4.4]nonan-3-yl)methanamine.
| Compound Name | (8-ethyl-1,4,6,9-tetraoxa-5-silaspiro[4.4]nonan-3-yl)methanamine |
|---|---|
| PubChem CID | 158864031 |
| Molecular Formula | C7H15NO4Si |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | (8-ethyl-1,4,6,9-tetraoxa-5-silaspiro[4.4]nonan-3-yl)methanamine |
| SMILES | CCC1CO[Si]2(OCC(CN)O2)O1 |
| InChI | InChI=1S/C7H15NO4Si/c1-2-6-4-9-13(11-6)10-5-7(3-8)12-13/h6-7H,2-5,8H2,1H3 |
| InChIKey | YYSIZWGTZANLRM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|