C16H21ClN2O2 — CID 158864606
(6aS,7S)-2-chloro-4-ethoxy-7,10a-dimethyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one (PubChem CID 158864606) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is (6aS,7S)-2-chloro-4-ethoxy-7,10a-dimethyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aS,7S)-2-chloro-4-ethoxy-7,10a-dimethyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 158864606 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (6aS,7S)-2-chloro-4-ethoxy-7,10a-dimethyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
| SMILES | CCOc1nc(Cl)nc2c1CC[C@H]1[C@H](C)C(=O)CCC21C |
| InChI | InChI=1S/C16H21ClN2O2/c1-4-21-14-10-5-6-11-9(2)12(20)7-8-16(11,3)13(10)18-15(17)19-14/h9,11H,4-8H2,1-3H3/t9-,11-,16?/m0/s1 |
| InChIKey | JBBMUNOBUMXPNJ-NEYSTMPUSA-N |
| XLogP | 3.35 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |