C40H39F2IO9S2 — CID 158864629
2-[2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1-difluoroethanesulfonate;(4-iodophenyl)-diphenylsulfanium (PubChem CID 158864629) has the molecular formula C40H39F2IO9S2 and a molecular weight of 892.78 g/mol. Its IUPAC name is 2-[2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1-difluoroethanesulfonate;(4-iodophenyl)-diphenylsulfanium.
| Compound Name | 2-[2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1-difluoroethanesulfonate;(4-iodophenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 158864629 |
| Molecular Formula | C40H39F2IO9S2 |
| Molecular Weight | 892.78 g/mol |
| Exact Mass | 892.10 |
| IUPAC Name | 2-[2-(adamantane-1-carbonyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxy-1,1-difluoroethanesulfonate;(4-iodophenyl)-diphenylsulfanium |
| SMILES | Ic1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=C1OC2C3CC(C2OC(=O)C24CC5CC(CC(C5)C2)C4)C(C(=O)OCC(F)(F)S(=O)(=O)[O-])C13 |
| InChI | InChI=1S/C22H26F2O9S.C18H14IS/c23-22(24,34(28,29)30)8-31-18(25)14-12-4-13-15(14)19(26)32-16(13)17(12)33-20(27)21-5-9-1-10(6-21)3-11(2-9)7-21;19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h9-17H,1-8H2,(H,28,29,30);1-14H/q;+1/p-1 |
| InChIKey | JBBOPYSSKVJFAH-UHFFFAOYSA-M |
| XLogP | 6.99 |
| TPSA | 136.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.78 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|