About 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde
2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde (PubChem CID 158864957) has the molecular formula C11H8F3N3O2S
and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde |
| PubChem CID | 158864957 |
| Molecular Formula | C11H8F3N3O2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde |
| SMILES | Nc1ncc(C=O)s1.O=Cc1cnccc1C(F)(F)F |
| InChI | InChI=1S/C7H4F3NO.C4H4N2OS/c8-7(9,10)6-1-2-11-3-5(6)4-12;5-4-6-1-3(2-7)8-4/h1-4H;1-2H,(H2,5,6) |
| InChIKey | JBCNODHHUXFJIA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde?
The IUPAC name of 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde (CID 158864957) is 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde.
What is the SMILES notation for 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde?
The canonical SMILES for 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde is Nc1ncc(C=O)s1.O=Cc1cnccc1C(F)(F)F.
What is the InChIKey of 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde?
The InChIKey is JBCNODHHUXFJIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3NO.C4H4N2OS/c8-7(9,10)6-1-2-11-3-5(6)4-12;5-4-6-1-3(2-7)8-4/h1-4H;1-2H,(H2,5,6).
What are the key properties of 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde?
2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde has a molecular weight of 303.27 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,3-thiazole-5-carbaldehyde;4-(trifluoromethyl)pyridine-3-carbaldehyde is sourced from PubChem (CID 158864957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).