C25H24N2O3 — CID 158865049
1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene;methyl 2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetate (PubChem CID 158865049) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene;methyl 2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetate.
| Compound Name | 1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene;methyl 2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 158865049 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene;methyl 2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1cn2c3c(cccc13)CCC2.c1cc2c3c(c1)ccn3CCC2 |
| InChI | InChI=1S/C14H13NO3.C11H11N/c1-18-14(17)13(16)11-8-15-7-3-5-9-4-2-6-10(11)12(9)15;1-3-9-5-2-7-12-8-6-10(4-1)11(9)12/h2,4,6,8H,3,5,7H2,1H3;1,3-4,6,8H,2,5,7H2 |
| InChIKey | JBCVDAIGIWRXCQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|