C24H24F2N8O — CID 158865341
2,3-diamino-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzonitrile;2,3-difluoro-4-hydrazinylbenzonitrile (PubChem CID 158865341) has the molecular formula C24H24F2N8O and a molecular weight of 478.51 g/mol. Its IUPAC name is 2,3-diamino-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzonitrile;2,3-difluoro-4-hydrazinylbenzonitrile.
| Compound Name | 2,3-diamino-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzonitrile;2,3-difluoro-4-hydrazinylbenzonitrile |
|---|---|
| PubChem CID | 158865341 |
| Molecular Formula | C24H24F2N8O |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2,3-diamino-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzonitrile;2,3-difluoro-4-hydrazinylbenzonitrile |
| SMILES | Cc1nn(-c2ccc(C#N)c(N)c2N)c2c1C(=O)CC(C)(C)C2.N#Cc1ccc(NN)c(F)c1F |
| InChI | InChI=1S/C17H19N5O.C7H5F2N3/c1-9-14-12(6-17(2,3)7-13(14)23)22(21-9)11-5-4-10(8-18)15(19)16(11)20;8-6-4(3-10)1-2-5(12-11)7(6)9/h4-5H,6-7,19-20H2,1-3H3;1-2,12H,11H2 |
| InChIKey | JBDVGRDDYDCFFR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 172.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|