C26H16F2N8O — CID 158865809
6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-(5-quinoxalin-6-yl-1H-pyrazol-3-yl)pyrimidin-4-amine (PubChem CID 158865809) has the molecular formula C26H16F2N8O and a molecular weight of 494.47 g/mol. Its IUPAC name is 6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-(5-quinoxalin-6-yl-1H-pyrazol-3-yl)pyrimidin-4-amine.
| Compound Name | 6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-(5-quinoxalin-6-yl-1H-pyrazol-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 158865809 |
| Molecular Formula | C26H16F2N8O |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 6-[(4,7-difluoro-2-methyl-1H-inden-5-yl)oxy]-5-isocyano-N-(5-quinoxalin-6-yl-1H-pyrazol-3-yl)pyrimidin-4-amine |
| SMILES | [C-]#[N+]c1c(Nc2cc(-c3ccc4nccnc4c3)[nH]n2)ncnc1Oc1cc(F)c2c(c1F)C=C(C)C2 |
| InChI | InChI=1S/C26H16F2N8O/c1-13-7-15-16(8-13)23(28)21(10-17(15)27)37-26-24(29-2)25(32-12-33-26)34-22-11-19(35-36-22)14-3-4-18-20(9-14)31-6-5-30-18/h3-6,8-12H,7H2,1H3,(H2,32,33,34,35,36) |
| InChIKey | MGSZROLZTKBWPU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|