About 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene
1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene (PubChem CID 158866458) has the molecular formula C13H18
and a molecular weight of 174.29 g/mol. Its IUPAC name is 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene |
| PubChem CID | 158866458 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene |
| SMILES | CC(C)c1cccc2c1C(C)CC2 |
| InChI | InChI=1S/C13H18/c1-9(2)12-6-4-5-11-8-7-10(3)13(11)12/h4-6,9-10H,7-8H2,1-3H3 |
| InChIKey | IQIDTUFVWURMFC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene?
The IUPAC name of 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene (CID 158866458) is 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene.
What is the SMILES notation for 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene?
The canonical SMILES for 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene is CC(C)c1cccc2c1C(C)CC2.
What is the InChIKey of 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene?
The InChIKey is IQIDTUFVWURMFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18/c1-9(2)12-6-4-5-11-8-7-10(3)13(11)12/h4-6,9-10H,7-8H2,1-3H3.
What are the key properties of 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene?
1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene has a molecular weight of 174.29 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-propan-2-yl-2,3-dihydro-1H-indene is sourced from PubChem (CID 158866458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).