C23H23N5O2S — CID 158866681
(1-methylidene-1-oxo-1,4-thiazepan-4-yl)-[6-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)naphthalen-1-yl]methanone (PubChem CID 158866681) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is (1-methylidene-1-oxo-1,4-thiazepan-4-yl)-[6-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)naphthalen-1-yl]methanone.
| Compound Name | (1-methylidene-1-oxo-1,4-thiazepan-4-yl)-[6-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)naphthalen-1-yl]methanone |
|---|---|
| PubChem CID | 158866681 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (1-methylidene-1-oxo-1,4-thiazepan-4-yl)-[6-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)naphthalen-1-yl]methanone |
| SMILES | C=S1(=O)CCCN(C(=O)c2cccc3cc(Nc4n[nH]c5cccnc45)ccc23)CC1 |
| InChI | InChI=1S/C23H23N5O2S/c1-31(30)13-4-11-28(12-14-31)23(29)19-6-2-5-16-15-17(8-9-18(16)19)25-22-21-20(26-27-22)7-3-10-24-21/h2-3,5-10,15H,1,4,11-14H2,(H2,25,26,27) |
| InChIKey | FAKHZEUXNYMJRQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|