About 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid
1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid (PubChem CID 158867248) has the molecular formula C13H20N2O4
and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid |
| PubChem CID | 158867248 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid |
| SMILES | CN1C=CC=C(C(=O)O)C1.O=C(O)C1CCCNC1 |
| InChI | InChI=1S/C7H9NO2.C6H11NO2/c1-8-4-2-3-6(5-8)7(9)10;8-6(9)5-2-1-3-7-4-5/h2-4H,5H2,1H3,(H,9,10);5,7H,1-4H2,(H,8,9) |
| InChIKey | JBJVFQDHGOUIEU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid?
The IUPAC name of 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid (CID 158867248) is 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid.
What is the SMILES notation for 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid?
The canonical SMILES for 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid is CN1C=CC=C(C(=O)O)C1.O=C(O)C1CCCNC1.
What is the InChIKey of 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid?
The InChIKey is JBJVFQDHGOUIEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2.C6H11NO2/c1-8-4-2-3-6(5-8)7(9)10;8-6(9)5-2-1-3-7-4-5/h2-4H,5H2,1H3,(H,9,10);5,7H,1-4H2,(H,8,9).
What are the key properties of 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid?
1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid has a molecular weight of 268.31 g/mol, XLogP of 0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2H-pyridine-3-carboxylic acid;piperidine-3-carboxylic acid is sourced from PubChem (CID 158867248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).