About 2,5-difluoro-2H-pyridin-1-ium 1-oxide
2,5-difluoro-2H-pyridin-1-ium 1-oxide (PubChem CID 158867463) has the molecular formula C5H4F2NO+
and a molecular weight of 132.09 g/mol. Its IUPAC name is 2,5-difluoro-2H-pyridin-1-ium 1-oxide.
Molecular Properties
| Compound Name | 2,5-difluoro-2H-pyridin-1-ium 1-oxide |
| PubChem CID | 158867463 |
| Molecular Formula | C5H4F2NO+ |
| Molecular Weight | 132.09 g/mol |
| Exact Mass | 132.03 |
| IUPAC Name | 2,5-difluoro-2H-pyridin-1-ium 1-oxide |
| SMILES | O=[N+]1C=C(F)C=CC1F |
| InChI | InChI=1S/C5H4F2NO/c6-4-1-2-5(7)8(9)3-4/h1-3,5H/q+1 |
| InChIKey | XEHVUFHFTDXIFU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.09 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,5-difluoro-2H-pyridin-1-ium 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluoro-2H-pyridin-1-ium 1-oxide?
The IUPAC name of 2,5-difluoro-2H-pyridin-1-ium 1-oxide (CID 158867463) is 2,5-difluoro-2H-pyridin-1-ium 1-oxide.
What is the SMILES notation for 2,5-difluoro-2H-pyridin-1-ium 1-oxide?
The canonical SMILES for 2,5-difluoro-2H-pyridin-1-ium 1-oxide is O=[N+]1C=C(F)C=CC1F.
What is the InChIKey of 2,5-difluoro-2H-pyridin-1-ium 1-oxide?
The InChIKey is XEHVUFHFTDXIFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F2NO/c6-4-1-2-5(7)8(9)3-4/h1-3,5H/q+1.
What are the key properties of 2,5-difluoro-2H-pyridin-1-ium 1-oxide?
2,5-difluoro-2H-pyridin-1-ium 1-oxide has a molecular weight of 132.09 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoro-2H-pyridin-1-ium 1-oxide is sourced from PubChem (CID 158867463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).