About 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride
4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride (PubChem CID 158867770) has the molecular formula C21H26ClN5O
and a molecular weight of 399.93 g/mol. Its IUPAC name is 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride.
Molecular Properties
| Compound Name | 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride |
| PubChem CID | 158867770 |
| Molecular Formula | C21H26ClN5O |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride |
| SMILES | Cc1cc(N2CCNCC2)ccc1-n1cnn(C(C)c2ccccc2)c1=O.Cl |
| InChI | InChI=1S/C21H25N5O.ClH/c1-16-14-19(24-12-10-22-11-13-24)8-9-20(16)25-15-23-26(21(25)27)17(2)18-6-4-3-5-7-18;/h3-9,14-15,17,22H,10-13H2,1-2H3;1H |
| InChIKey | CEHVMKPDPQGTOL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride?
The IUPAC name of 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride (CID 158867770) is 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride.
What is the SMILES notation for 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride?
The canonical SMILES for 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride is Cc1cc(N2CCNCC2)ccc1-n1cnn(C(C)c2ccccc2)c1=O.Cl.
What is the InChIKey of 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride?
The InChIKey is CEHVMKPDPQGTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N5O.ClH/c1-16-14-19(24-12-10-22-11-13-24)8-9-20(16)25-15-23-26(21(25)27)17(2)18-6-4-3-5-7-18;/h3-9,14-15,17,22H,10-13H2,1-2H3;1H.
What are the key properties of 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride?
4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride has a molecular weight of 399.93 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-4-piperazin-1-ylphenyl)-2-(1-phenylethyl)-1,2,4-triazol-3-one;hydrochloride is sourced from PubChem (CID 158867770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).