C21H25N5O4 — CID 158869090
carbon dioxide;7,8-dimethyl-10-[2-[[(3R)-3-methylcyclopentyl]amino]ethyl]benzo[g]pteridine-2,4-dione (PubChem CID 158869090) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is carbon dioxide;7,8-dimethyl-10-[2-[[(3R)-3-methylcyclopentyl]amino]ethyl]benzo[g]pteridine-2,4-dione.
| Compound Name | carbon dioxide;7,8-dimethyl-10-[2-[[(3R)-3-methylcyclopentyl]amino]ethyl]benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 158869090 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | carbon dioxide;7,8-dimethyl-10-[2-[[(3R)-3-methylcyclopentyl]amino]ethyl]benzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCNC3CC[C@@H](C)C3)c2cc1C.O=C=O |
| InChI | InChI=1S/C20H25N5O2.CO2/c1-11-4-5-14(8-11)21-6-7-25-16-10-13(3)12(2)9-15(16)22-17-18(25)23-20(27)24-19(17)26;2-1-3/h9-11,14,21H,4-8H2,1-3H3,(H,24,26,27);/t11-,14?;/m1./s1 |
| InChIKey | JBPQSGQZLYHOBG-JEVWNTBDSA-N |
| XLogP | 1.40 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|