About 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole
2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole (PubChem CID 158870160) has the molecular formula C9H18N2S7
and a molecular weight of 378.73 g/mol. Its IUPAC name is 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole.
Molecular Properties
| Compound Name | 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole |
| PubChem CID | 158870160 |
| Molecular Formula | C9H18N2S7 |
| Molecular Weight | 378.73 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole |
| SMILES | C1=CSSS1.CCC.S=C(S)NCCNC(=S)S |
| InChI | InChI=1S/C4H8N2S4.C3H8.C2H2S3/c7-3(8)5-1-2-6-4(9)10;1-3-2;1-2-4-5-3-1/h1-2H2,(H2,5,7,8)(H2,6,9,10);3H2,1-2H3;1-2H |
| InChIKey | JBSYGRRPKQNZPB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole?
The IUPAC name of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole (CID 158870160) is 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole.
What is the SMILES notation for 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole?
The canonical SMILES for 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole is C1=CSSS1.CCC.S=C(S)NCCNC(=S)S.
What is the InChIKey of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole?
The InChIKey is JBSYGRRPKQNZPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2S4.C3H8.C2H2S3/c7-3(8)5-1-2-6-4(9)10;1-3-2;1-2-4-5-3-1/h1-2H2,(H2,5,7,8)(H2,6,9,10);3H2,1-2H3;1-2H.
What are the key properties of 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole?
2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole has a molecular weight of 378.73 g/mol, XLogP of 4.51, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dithiocarboxyamino)ethylcarbamodithioic acid;propane;trithiole is sourced from PubChem (CID 158870160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).