C12H10F3N3O4S — CID 158870435
methyl 2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]acetate;2,2,2-trifluoroacetate (PubChem CID 158870435) has the molecular formula C12H10F3N3O4S and a molecular weight of 349.29 g/mol. Its IUPAC name is methyl 2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]acetate;2,2,2-trifluoroacetate.
| Compound Name | methyl 2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]acetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 158870435 |
| Molecular Formula | C12H10F3N3O4S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | methyl 2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]acetate;2,2,2-trifluoroacetate |
| SMILES | COC(=O)C[n+]1ccc(-c2nccs2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C10H10N3O2S.C2HF3O2/c1-15-9(14)7-13-4-2-8(6-12-13)10-11-3-5-16-10;3-2(4,5)1(6)7/h2-6H,7H2,1H3;(H,6,7)/q+1;/p-1 |
| InChIKey | PNLFNLURZQVHNO-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 96.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|