C44H46BBrN6O2 — CID 158871372
4-bromopyridine-2,6-diamine;4-[(E)-1,2-diphenylethenyl]pyridine-2,6-diamine;2-[(Z)-1,2-diphenylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 158871372) has the molecular formula C44H46BBrN6O2 and a molecular weight of 781.61 g/mol. Its IUPAC name is 4-bromopyridine-2,6-diamine;4-[(E)-1,2-diphenylethenyl]pyridine-2,6-diamine;2-[(Z)-1,2-diphenylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 4-bromopyridine-2,6-diamine;4-[(E)-1,2-diphenylethenyl]pyridine-2,6-diamine;2-[(Z)-1,2-diphenylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 158871372 |
| Molecular Formula | C44H46BBrN6O2 |
| Molecular Weight | 781.61 g/mol |
| Exact Mass | 780.30 |
| IUPAC Name | 4-bromopyridine-2,6-diamine;4-[(E)-1,2-diphenylethenyl]pyridine-2,6-diamine;2-[(Z)-1,2-diphenylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(/C(=C/c2ccccc2)c2ccccc2)OC1(C)C.Nc1cc(/C(=C/c2ccccc2)c2ccccc2)cc(N)n1.Nc1cc(Br)cc(N)n1 |
| InChI | InChI=1S/C20H23BO2.C19H17N3.C5H6BrN3/c1-19(2)20(3,4)23-21(22-19)18(17-13-9-6-10-14-17)15-16-11-7-5-8-12-16;20-18-12-16(13-19(21)22-18)17(15-9-5-2-6-10-15)11-14-7-3-1-4-8-14;6-3-1-4(7)9-5(8)2-3/h5-15H,1-4H3;1-13H,(H4,20,21,22);1-2H,(H4,7,8,9)/b18-15+;17-11+; |
| InChIKey | JBWSDNHDBYJODL-AZYCECKRSA-N |
| XLogP | 9.70 |
| TPSA | 148.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.61 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|