C53H40N6O2Zn — CID 158871707
zinc;(E)-2-cyano-3-(5,10,15,20-tetraphenylporphyrin-21,23-diid-2-yl)prop-2-enoate;piperidin-1-ium (PubChem CID 158871707) has the molecular formula C53H40N6O2Zn and a molecular weight of 858.33 g/mol. Its IUPAC name is zinc;(E)-2-cyano-3-(5,10,15,20-tetraphenylporphyrin-21,23-diid-2-yl)prop-2-enoate;piperidin-1-ium.
| Compound Name | zinc;(E)-2-cyano-3-(5,10,15,20-tetraphenylporphyrin-21,23-diid-2-yl)prop-2-enoate;piperidin-1-ium |
|---|---|
| PubChem CID | 158871707 |
| Molecular Formula | C53H40N6O2Zn |
| Molecular Weight | 858.33 g/mol |
| Exact Mass | 856.25 |
| IUPAC Name | zinc;(E)-2-cyano-3-(5,10,15,20-tetraphenylporphyrin-21,23-diid-2-yl)prop-2-enoate;piperidin-1-ium |
| SMILES | C1CC[NH2+]CC1.N#C/C(=C\c1cc2[n-]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c(-c3ccccc3)c3nc(c2-c2ccccc2)C=C3)C=C1)C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/C48H30N5O2.C5H11N.Zn/c49-29-35(48(54)55)27-34-28-42-45(32-17-9-3-10-18-32)40-24-23-38(51-40)43(30-13-5-1-6-14-30)36-21-22-37(50-36)44(31-15-7-2-8-16-31)39-25-26-41(52-39)46(47(34)53-42)33-19-11-4-12-20-33;1-2-4-6-5-3-1;/h1-28H,(H2-,50,51,52,53,54,55);6H,1-5H2;/q-1;;+2/p-1/b35-27+,43-36-,43-38-,44-37-,44-39-,45-40-,45-42-,46-41-,47-46-;; |
| InChIKey | JBXRHLRTPXORSD-QXWSLBRXSA-M |
| XLogP | 8.97 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.33 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|