C15H25NO3 — CID 158872294
2,3-dimethyl-4-(2-methylanilino)-4-oxobutanoic acid;methane (PubChem CID 158872294) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2,3-dimethyl-4-(2-methylanilino)-4-oxobutanoic acid;methane.
| Compound Name | 2,3-dimethyl-4-(2-methylanilino)-4-oxobutanoic acid;methane |
|---|---|
| PubChem CID | 158872294 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2,3-dimethyl-4-(2-methylanilino)-4-oxobutanoic acid;methane |
| SMILES | C.C.Cc1ccccc1NC(=O)C(C)C(C)C(=O)O |
| InChI | InChI=1S/C13H17NO3.2CH4/c1-8-6-4-5-7-11(8)14-12(15)9(2)10(3)13(16)17;;/h4-7,9-10H,1-3H3,(H,14,15)(H,16,17);2*1H4 |
| InChIKey | JBZMUOFENKRWKW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |