C25H35N5O5S2 — CID 158872840
CID 158872840 (PubChem CID 158872840) has the molecular formula C25H35N5O5S2 and a molecular weight of 549.72 g/mol.
| Compound Name | CID 158872840 |
|---|---|
| PubChem CID | 158872840 |
| Molecular Formula | C25H35N5O5S2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | — |
| SMILES | CCCC1(N(C)C(=O)OCc2c(-c3ccc(O[C@H]4CCC[C@H](C(=O)O)C4)c(C)n3)nnn2C)CC1.S=S |
| InChI | InChI=1S/C25H35N5O5.S2/c1-5-11-25(12-13-25)29(3)24(33)34-15-20-22(27-28-30(20)4)19-9-10-21(16(2)26-19)35-18-8-6-7-17(14-18)23(31)32;1-2/h9-10,17-18H,5-8,11-15H2,1-4H3,(H,31,32);/t17-,18-;/m0./s1 |
| InChIKey | JCBFGVNQELHLDB-APTPAJQOSA-N |
| XLogP | 4.10 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |