C29H42O4S — CID 15887302
[(2E,6Z)-3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate (PubChem CID 15887302) has the molecular formula C29H42O4S and a molecular weight of 486.72 g/mol. Its IUPAC name is [(2E,6Z)-3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate.
| Compound Name | [(2E,6Z)-3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 15887302 |
| Molecular Formula | C29H42O4S |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [(2E,6Z)-3,7-dimethyl-9-(4-methylphenyl)sulfonyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(/C)CC(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H42O4S/c1-21(17-19-33-25(5)30)10-8-11-23(3)20-27(28-24(4)12-9-18-29(28,6)7)34(31,32)26-15-13-22(2)14-16-26/h11,13-17,27H,8-10,12,18-20H2,1-7H3/b21-17+,23-11- |
| InChIKey | RRVIGMFXYGWNHD-FZPGCJMOSA-N |
| XLogP | 7.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|