About 5-propoxy-2,3-dihydroisoindol-1-one
5-propoxy-2,3-dihydroisoindol-1-one (PubChem CID 158874479) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 5-propoxy-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 5-propoxy-2,3-dihydroisoindol-1-one |
| PubChem CID | 158874479 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 5-propoxy-2,3-dihydroisoindol-1-one |
| SMILES | CCCOc1ccc2c(c1)CNC2=O |
| InChI | InChI=1S/C11H13NO2/c1-2-5-14-9-3-4-10-8(6-9)7-12-11(10)13/h3-4,6H,2,5,7H2,1H3,(H,12,13) |
| InChIKey | UXKKTESYCVNJID-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propoxy-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propoxy-2,3-dihydroisoindol-1-one?
The IUPAC name of 5-propoxy-2,3-dihydroisoindol-1-one (CID 158874479) is 5-propoxy-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 5-propoxy-2,3-dihydroisoindol-1-one?
The canonical SMILES for 5-propoxy-2,3-dihydroisoindol-1-one is CCCOc1ccc2c(c1)CNC2=O.
What is the InChIKey of 5-propoxy-2,3-dihydroisoindol-1-one?
The InChIKey is UXKKTESYCVNJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-5-14-9-3-4-10-8(6-9)7-12-11(10)13/h3-4,6H,2,5,7H2,1H3,(H,12,13).
What are the key properties of 5-propoxy-2,3-dihydroisoindol-1-one?
5-propoxy-2,3-dihydroisoindol-1-one has a molecular weight of 191.23 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propoxy-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 158874479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).