About 2,2-dimethylbutanamide;imidazol-2-one
2,2-dimethylbutanamide;imidazol-2-one (PubChem CID 158874669) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2,2-dimethylbutanamide;imidazol-2-one.
Molecular Properties
| Compound Name | 2,2-dimethylbutanamide;imidazol-2-one |
| PubChem CID | 158874669 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2,2-dimethylbutanamide;imidazol-2-one |
| SMILES | CCC(C)(C)C(N)=O.O=C1N=CC=N1 |
| InChI | InChI=1S/C6H13NO.C3H2N2O/c1-4-6(2,3)5(7)8;6-3-4-1-2-5-3/h4H2,1-3H3,(H2,7,8);1-2H |
| InChIKey | JCHAJHBHYUAIEG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethylbutanamide;imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylbutanamide;imidazol-2-one?
The IUPAC name of 2,2-dimethylbutanamide;imidazol-2-one (CID 158874669) is 2,2-dimethylbutanamide;imidazol-2-one.
What is the SMILES notation for 2,2-dimethylbutanamide;imidazol-2-one?
The canonical SMILES for 2,2-dimethylbutanamide;imidazol-2-one is CCC(C)(C)C(N)=O.O=C1N=CC=N1.
What is the InChIKey of 2,2-dimethylbutanamide;imidazol-2-one?
The InChIKey is JCHAJHBHYUAIEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C3H2N2O/c1-4-6(2,3)5(7)8;6-3-4-1-2-5-3/h4H2,1-3H3,(H2,7,8);1-2H.
What are the key properties of 2,2-dimethylbutanamide;imidazol-2-one?
2,2-dimethylbutanamide;imidazol-2-one has a molecular weight of 197.24 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylbutanamide;imidazol-2-one is sourced from PubChem (CID 158874669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).