C21H28BrN3O3 — CID 158875148
ethyl 2-[[2-(1-cyclohexylpyrazol-2-ium-2-yl)acetyl]amino]-3-methylbenzoate bromide (PubChem CID 158875148) has the molecular formula C21H28BrN3O3 and a molecular weight of 450.38 g/mol. Its IUPAC name is ethyl 2-[[2-(1-cyclohexylpyrazol-2-ium-2-yl)acetyl]amino]-3-methylbenzoate bromide.
| Compound Name | ethyl 2-[[2-(1-cyclohexylpyrazol-2-ium-2-yl)acetyl]amino]-3-methylbenzoate bromide |
|---|---|
| PubChem CID | 158875148 |
| Molecular Formula | C21H28BrN3O3 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | ethyl 2-[[2-(1-cyclohexylpyrazol-2-ium-2-yl)acetyl]amino]-3-methylbenzoate bromide |
| SMILES | CCOC(=O)c1cccc(C)c1NC(=O)C[n+]1cccn1C1CCCCC1.[Br-] |
| InChI | InChI=1S/C21H27N3O3.BrH/c1-3-27-21(26)18-12-7-9-16(2)20(18)22-19(25)15-23-13-8-14-24(23)17-10-5-4-6-11-17;/h7-9,12-14,17H,3-6,10-11,15H2,1-2H3;1H |
| InChIKey | OEBGVQBLSMNKLY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|