About 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate
2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate (PubChem CID 158876185) has the molecular formula C18H11BrN4O5S2
and a molecular weight of 507.35 g/mol. Its IUPAC name is 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate.
Molecular Properties
| Compound Name | 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate |
| PubChem CID | 158876185 |
| Molecular Formula | C18H11BrN4O5S2 |
| Molecular Weight | 507.35 g/mol |
| Exact Mass | 505.94 |
| IUPAC Name | 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate |
| SMILES | N#CSCC(=O)c1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1ccc(-c2csc(Br)n2)cc1 |
| InChI | InChI=1S/C9H5BrN2O2S.C9H6N2O3S/c10-9-11-8(5-15-9)6-1-3-7(4-2-6)12(13)14;10-6-15-5-9(12)7-1-3-8(4-2-7)11(13)14/h1-5H;1-4H,5H2 |
| InChIKey | JCLPKNQGDKGWPC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 140.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.35 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate?
The IUPAC name of 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate (CID 158876185) is 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate.
What is the SMILES notation for 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate?
The canonical SMILES for 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate is N#CSCC(=O)c1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1ccc(-c2csc(Br)n2)cc1.
What is the InChIKey of 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate?
The InChIKey is JCLPKNQGDKGWPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrN2O2S.C9H6N2O3S/c10-9-11-8(5-15-9)6-1-3-7(4-2-6)12(13)14;10-6-15-5-9(12)7-1-3-8(4-2-7)11(13)14/h1-5H;1-4H,5H2.
What are the key properties of 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate?
2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate has a molecular weight of 507.35 g/mol, XLogP of 5.47, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(4-nitrophenyl)-1,3-thiazole;[2-(4-nitrophenyl)-2-oxoethyl] thiocyanate is sourced from PubChem (CID 158876185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).