C24H33BO8Pb — CID 158876904
[diacetyloxy-(2,4,6-trimethylphenyl)plumbyl] acetate;(2,4,6-trimethylphenyl)boronic acid (PubChem CID 158876904) has the molecular formula C24H33BO8Pb and a molecular weight of 667.53 g/mol. Its IUPAC name is [diacetyloxy-(2,4,6-trimethylphenyl)plumbyl] acetate;(2,4,6-trimethylphenyl)boronic acid.
| Compound Name | [diacetyloxy-(2,4,6-trimethylphenyl)plumbyl] acetate;(2,4,6-trimethylphenyl)boronic acid |
|---|---|
| PubChem CID | 158876904 |
| Molecular Formula | C24H33BO8Pb |
| Molecular Weight | 667.53 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | [diacetyloxy-(2,4,6-trimethylphenyl)plumbyl] acetate;(2,4,6-trimethylphenyl)boronic acid |
| SMILES | CC(=O)O[Pb](OC(C)=O)(OC(C)=O)c1c(C)cc(C)cc1C.Cc1cc(C)c(B(O)O)c(C)c1 |
| InChI | InChI=1S/C9H13BO2.C9H11.3C2H4O2.Pb/c1-6-4-7(2)9(10(11)12)8(3)5-6;1-7-4-8(2)6-9(3)5-7;3*1-2(3)4;/h4-5,11-12H,1-3H3;4-5H,1-3H3;3*1H3,(H,3,4);/q;;;;;+3/p-3 |
| InChIKey | JCNYSJAEEZQBPM-UHFFFAOYSA-K |
| XLogP | 1.74 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|