C42H39N5O4S — CID 158877281
tert-butyl N-[1-[4-[4-[3-(benzenesulfonylmethyl)phenyl]-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamate (PubChem CID 158877281) has the molecular formula C42H39N5O4S and a molecular weight of 709.87 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[4-[3-(benzenesulfonylmethyl)phenyl]-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[4-[3-(benzenesulfonylmethyl)phenyl]-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 158877281 |
| Molecular Formula | C42H39N5O4S |
| Molecular Weight | 709.87 g/mol |
| Exact Mass | 709.27 |
| IUPAC Name | tert-butyl N-[1-[4-[4-[3-(benzenesulfonylmethyl)phenyl]-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-c3c(-c4cccc(CS(=O)(=O)c5ccccc5)c4)nc4n3-c3cccnc3Nc3ccccc3-4)cc2)CCC1 |
| InChI | InChI=1S/C42H39N5O4S/c1-41(2,3)51-40(48)46-42(23-11-24-42)31-21-19-29(20-22-31)37-36(30-13-9-12-28(26-30)27-52(49,50)32-14-5-4-6-15-32)45-39-33-16-7-8-17-34(33)44-38-35(47(37)39)18-10-25-43-38/h4-10,12-22,25-26H,11,23-24,27H2,1-3H3,(H,43,44)(H,46,48) |
| InChIKey | AXSVFTSZBUOJNG-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.87 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |