C27H21F3N2O — CID 15887787
(E)-1-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 15887787) has the molecular formula C27H21F3N2O and a molecular weight of 446.47 g/mol. Its IUPAC name is (E)-1-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 15887787 |
| Molecular Formula | C27H21F3N2O |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (E)-1-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)N1CCc2c([nH]c3ccccc23)C1c1ccccc1 |
| InChI | InChI=1S/C27H21F3N2O/c28-27(29,30)20-13-10-18(11-14-20)12-15-24(33)32-17-16-22-21-8-4-5-9-23(21)31-25(22)26(32)19-6-2-1-3-7-19/h1-15,26,31H,16-17H2/b15-12+ |
| InChIKey | VLHBCNVIIFJRAU-NTCAYCPXSA-N |
| XLogP | 6.37 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|